C26H28ClFN4O4 — CID 87801789
7-[(4Z)-3-(aminomethyl)-3-methyl-4-phenylmethoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid;hydrochloride (PubChem CID 87801789) has the molecular formula C26H28ClFN4O4 and a molecular weight of 514.99 g/mol. Its IUPAC name is 7-[(4Z)-3-(aminomethyl)-3-methyl-4-phenylmethoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid;hydrochloride.
| Compound Name | 7-[(4Z)-3-(aminomethyl)-3-methyl-4-phenylmethoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 87801789 |
| Molecular Formula | C26H28ClFN4O4 |
| Molecular Weight | 514.99 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 7-[(4Z)-3-(aminomethyl)-3-methyl-4-phenylmethoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid;hydrochloride |
| SMILES | CC1(CN)CN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)C/C1=N\OCc1ccccc1.Cl |
| InChI | InChI=1S/C26H27FN4O4.ClH/c1-26(14-28)15-30(12-23(26)29-35-13-16-5-3-2-4-6-16)22-10-21-18(9-20(22)27)24(32)19(25(33)34)11-31(21)17-7-8-17;/h2-6,9-11,17H,7-8,12-15,28H2,1H3,(H,33,34);1H/b29-23+; |
| InChIKey | BQTSEUDXIDDLGD-BTCGTBLPSA-N |
| XLogP | 3.95 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.99 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|