C25H25FN4O4 — CID 174360264
7-(5-amino-3-phenylmethoxyiminopentanimidoyl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 174360264) has the molecular formula C25H25FN4O4 and a molecular weight of 464.50 g/mol. Its IUPAC name is 7-(5-amino-3-phenylmethoxyiminopentanimidoyl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(5-amino-3-phenylmethoxyiminopentanimidoyl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 174360264 |
| Molecular Formula | C25H25FN4O4 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 7-(5-amino-3-phenylmethoxyiminopentanimidoyl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | [H]/N=C(\CC(CCN)=NOCc1ccccc1)c1cc2c(cc1F)c(=O)c(C(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C25H25FN4O4/c26-21-11-19-23(30(17-6-7-17)13-20(24(19)31)25(32)33)12-18(21)22(28)10-16(8-9-27)29-34-14-15-4-2-1-3-5-15/h1-5,11-13,17,28H,6-10,14,27H2,(H,32,33)/b28-22+,29-16? |
| InChIKey | AGHVQGJECXXRLX-TUCSDBAISA-N |
| XLogP | 3.85 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|