C11H12O2 — CID 87802317
(2E,4E)-3-methyl-5-(2H-pyran-2-yl)penta-2,4-dienal (PubChem CID 87802317) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is (2E,4E)-3-methyl-5-(2H-pyran-2-yl)penta-2,4-dienal.
| Compound Name | (2E,4E)-3-methyl-5-(2H-pyran-2-yl)penta-2,4-dienal |
|---|---|
| PubChem CID | 87802317 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (2E,4E)-3-methyl-5-(2H-pyran-2-yl)penta-2,4-dienal |
| SMILES | CC(/C=C/C1C=CC=CO1)=C\C=O |
| InChI | InChI=1S/C11H12O2/c1-10(7-8-12)5-6-11-4-2-3-9-13-11/h2-9,11H,1H3/b6-5+,10-7+ |
| InChIKey | NAZNQBNTJDSMQD-WEYXYWBQSA-N |
| XLogP | 2.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|