C11H7Br5O3 — CID 87805281
(E)-2-(2,3,4,5,6-pentabromophenoxy)pent-2-enoic acid (PubChem CID 87805281) has the molecular formula C11H7Br5O3 and a molecular weight of 586.69 g/mol. Its IUPAC name is (E)-2-(2,3,4,5,6-pentabromophenoxy)pent-2-enoic acid.
| Compound Name | (E)-2-(2,3,4,5,6-pentabromophenoxy)pent-2-enoic acid |
|---|---|
| PubChem CID | 87805281 |
| Molecular Formula | C11H7Br5O3 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 581.63 |
| IUPAC Name | (E)-2-(2,3,4,5,6-pentabromophenoxy)pent-2-enoic acid |
| SMILES | CC/C=C(/Oc1c(Br)c(Br)c(Br)c(Br)c1Br)C(=O)O |
| InChI | InChI=1S/C11H7Br5O3/c1-2-3-4(11(17)18)19-10-8(15)6(13)5(12)7(14)9(10)16/h3H,2H2,1H3,(H,17,18)/b4-3+ |
| InChIKey | SQEDYJBAENYKQL-ONEGZZNKSA-N |
| XLogP | 6.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|