C21H17Cl3N4O4S — CID 87810415
2-naphthalen-1-yl-N-[2,2,2-trichloro-1-[(4-nitrophenyl)carbamoyl-sulfanylamino]ethyl]acetamide (PubChem CID 87810415) has the molecular formula C21H17Cl3N4O4S and a molecular weight of 527.82 g/mol. Its IUPAC name is 2-naphthalen-1-yl-N-[2,2,2-trichloro-1-[(4-nitrophenyl)carbamoyl-sulfanylamino]ethyl]acetamide.
| Compound Name | 2-naphthalen-1-yl-N-[2,2,2-trichloro-1-[(4-nitrophenyl)carbamoyl-sulfanylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 87810415 |
| Molecular Formula | C21H17Cl3N4O4S |
| Molecular Weight | 527.82 g/mol |
| Exact Mass | 526.00 |
| IUPAC Name | 2-naphthalen-1-yl-N-[2,2,2-trichloro-1-[(4-nitrophenyl)carbamoyl-sulfanylamino]ethyl]acetamide |
| SMILES | O=C(Cc1cccc2ccccc12)NC(N(S)C(=O)Nc1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H17Cl3N4O4S/c22-21(23,24)19(27(33)20(30)25-15-8-10-16(11-9-15)28(31)32)26-18(29)12-14-6-3-5-13-4-1-2-7-17(13)14/h1-11,19,33H,12H2,(H,25,30)(H,26,29) |
| InChIKey | WCFUKBCDOPGSMX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|