C12H13N3O4 — CID 87812787
N-hydroxy-4'-oxospiro[cyclopentane-1,9'-pyrimido[2,1-c][1,4]oxazine]-2'-carboxamide (PubChem CID 87812787) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is N-hydroxy-4'-oxospiro[cyclopentane-1,9'-pyrimido[2,1-c][1,4]oxazine]-2'-carboxamide.
| Compound Name | N-hydroxy-4'-oxospiro[cyclopentane-1,9'-pyrimido[2,1-c][1,4]oxazine]-2'-carboxamide |
|---|---|
| PubChem CID | 87812787 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-hydroxy-4'-oxospiro[cyclopentane-1,9'-pyrimido[2,1-c][1,4]oxazine]-2'-carboxamide |
| SMILES | O=C(NO)c1cc(=O)n2c(n1)C1(CCCC1)OC=C2 |
| InChI | InChI=1S/C12H13N3O4/c16-9-7-8(10(17)14-18)13-11-12(3-1-2-4-12)19-6-5-15(9)11/h5-7,18H,1-4H2,(H,14,17) |
| InChIKey | SCFLCHLEOFBSSO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|