C18H24N2O8S2 — CID 87813115
1-hydroxy-2-[4-[4-[(2-hydroxy-2-sulfoethyl)amino]-3-methylphenyl]-2-methylanilino]ethanesulfonic acid (PubChem CID 87813115) has the molecular formula C18H24N2O8S2 and a molecular weight of 460.53 g/mol. Its IUPAC name is 1-hydroxy-2-[4-[4-[(2-hydroxy-2-sulfoethyl)amino]-3-methylphenyl]-2-methylanilino]ethanesulfonic acid.
| Compound Name | 1-hydroxy-2-[4-[4-[(2-hydroxy-2-sulfoethyl)amino]-3-methylphenyl]-2-methylanilino]ethanesulfonic acid |
|---|---|
| PubChem CID | 87813115 |
| Molecular Formula | C18H24N2O8S2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-hydroxy-2-[4-[4-[(2-hydroxy-2-sulfoethyl)amino]-3-methylphenyl]-2-methylanilino]ethanesulfonic acid |
| SMILES | Cc1cc(-c2ccc(NCC(O)S(=O)(=O)O)c(C)c2)ccc1NCC(O)S(=O)(=O)O |
| InChI | InChI=1S/C18H24N2O8S2/c1-11-7-13(3-5-15(11)19-9-17(21)29(23,24)25)14-4-6-16(12(2)8-14)20-10-18(22)30(26,27)28/h3-8,17-22H,9-10H2,1-2H3,(H,23,24,25)(H,26,27,28) |
| InChIKey | QUIHXNFNABNUGP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 173.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|