C23H24N4O3 — CID 87815436
2-(4H-chromeno[3,4-d]pyrazol-1-yl)-2-[4-(3-methoxyphenyl)piperazin-1-yl]acetaldehyde (PubChem CID 87815436) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-2-[4-(3-methoxyphenyl)piperazin-1-yl]acetaldehyde.
| Compound Name | 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-2-[4-(3-methoxyphenyl)piperazin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 87815436 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-2-[4-(3-methoxyphenyl)piperazin-1-yl]acetaldehyde |
| SMILES | COc1cccc(N2CCN(C(C=O)n3ncc4c3-c3ccccc3OC4)CC2)c1 |
| InChI | InChI=1S/C23H24N4O3/c1-29-19-6-4-5-18(13-19)25-9-11-26(12-10-25)22(15-28)27-23-17(14-24-27)16-30-21-8-3-2-7-20(21)23/h2-8,13-15,22H,9-12,16H2,1H3 |
| InChIKey | DRJMNSRLWHQDHC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|