C18H11Cl2Si — CID 87815916
CID 87815916 (PubChem CID 87815916) has the molecular formula C18H11Cl2Si and a molecular weight of 326.28 g/mol.
| Compound Name | CID 87815916 |
|---|---|
| PubChem CID | 87815916 |
| Molecular Formula | C18H11Cl2Si |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | — |
| SMILES | Cl[Si](Cl)c1cccc2ccc3cc4ccccc4cc3c12 |
| InChI | InChI=1S/C18H11Cl2Si/c19-21(20)17-7-3-6-12-8-9-15-10-13-4-1-2-5-14(13)11-16(15)18(12)17/h1-11H |
| InChIKey | JHWGUIMJUPXTHW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|