C15H15N3O6S — CID 87816012
[carbamoyl(methylsulfanyl)carbamoyl] 3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 87816012) has the molecular formula C15H15N3O6S and a molecular weight of 365.37 g/mol. Its IUPAC name is [carbamoyl(methylsulfanyl)carbamoyl] 3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [carbamoyl(methylsulfanyl)carbamoyl] 3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 87816012 |
| Molecular Formula | C15H15N3O6S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | [carbamoyl(methylsulfanyl)carbamoyl] 3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | COc1ccc(-c2noc(C)c2C(=O)OC(=O)N(SC)C(N)=O)cc1 |
| InChI | InChI=1S/C15H15N3O6S/c1-8-11(13(19)23-15(21)18(25-3)14(16)20)12(17-24-8)9-4-6-10(22-2)7-5-9/h4-7H,1-3H3,(H2,16,20) |
| InChIKey | RITFQWVVFIRDEQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|