C9H14O7S — CID 87816206
3-(1-carboxy-3-methylsulfanylpropoxy)-2-(hydroxymethyl)-3-oxopropanoic acid (PubChem CID 87816206) has the molecular formula C9H14O7S and a molecular weight of 266.27 g/mol. Its IUPAC name is 3-(1-carboxy-3-methylsulfanylpropoxy)-2-(hydroxymethyl)-3-oxopropanoic acid.
| Compound Name | 3-(1-carboxy-3-methylsulfanylpropoxy)-2-(hydroxymethyl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 87816206 |
| Molecular Formula | C9H14O7S |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-(1-carboxy-3-methylsulfanylpropoxy)-2-(hydroxymethyl)-3-oxopropanoic acid |
| SMILES | CSCCC(OC(=O)C(CO)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14O7S/c1-17-3-2-6(8(13)14)16-9(15)5(4-10)7(11)12/h5-6,10H,2-4H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | ZSSVDWZXZIJYOK-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|