C10H18N4O8 — CID 87816587
2,3-dihydroxybutanedioic acid;3-(dimethylcarbamoylimino)-1,1-dimethylurea (PubChem CID 87816587) has the molecular formula C10H18N4O8 and a molecular weight of 322.27 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;3-(dimethylcarbamoylimino)-1,1-dimethylurea.
| Compound Name | 2,3-dihydroxybutanedioic acid;3-(dimethylcarbamoylimino)-1,1-dimethylurea |
|---|---|
| PubChem CID | 87816587 |
| Molecular Formula | C10H18N4O8 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;3-(dimethylcarbamoylimino)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)N=NC(=O)N(C)C.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C6H12N4O2.C4H6O6/c1-9(2)5(11)7-8-6(12)10(3)4;5-1(3(7)8)2(6)4(9)10/h1-4H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | ZKURCKQYPHQLAX-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 180.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|