About 3-(dimethylcarbamoylimino)-1,1-dimethylurea
3-(dimethylcarbamoylimino)-1,1-dimethylurea (PubChem CID 4278) has the molecular formula C6H12N4O2
and a molecular weight of 172.19 g/mol. Its IUPAC name is 3-(dimethylcarbamoylimino)-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-(dimethylcarbamoylimino)-1,1-dimethylurea |
| PubChem CID | 4278 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 3-(dimethylcarbamoylimino)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)N=NC(=O)N(C)C |
| InChI | InChI=1S/C6H12N4O2/c1-9(2)5(11)7-8-6(12)10(3)4/h1-4H3 |
| InChIKey | VLSDXINSOMDCBK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylcarbamoylimino)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylcarbamoylimino)-1,1-dimethylurea?
The IUPAC name of 3-(dimethylcarbamoylimino)-1,1-dimethylurea (CID 4278) is 3-(dimethylcarbamoylimino)-1,1-dimethylurea.
What is the SMILES notation for 3-(dimethylcarbamoylimino)-1,1-dimethylurea?
The canonical SMILES for 3-(dimethylcarbamoylimino)-1,1-dimethylurea is CN(C)C(=O)N=NC(=O)N(C)C.
What is the InChIKey of 3-(dimethylcarbamoylimino)-1,1-dimethylurea?
The InChIKey is VLSDXINSOMDCBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O2/c1-9(2)5(11)7-8-6(12)10(3)4/h1-4H3.
What are the key properties of 3-(dimethylcarbamoylimino)-1,1-dimethylurea?
3-(dimethylcarbamoylimino)-1,1-dimethylurea has a molecular weight of 172.19 g/mol, XLogP of 0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylcarbamoylimino)-1,1-dimethylurea is sourced from PubChem (CID 4278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).