About N,N-di((113C)methyl)acetamide;zinc
N,N-di((113C)methyl)acetamide;zinc (PubChem CID 175804648) has the molecular formula C4H8NOZn-
and a molecular weight of 153.49 g/mol. Its IUPAC name is N,N-di((113C)methyl)acetamide;zinc.
Molecular Properties
| Compound Name | N,N-di((113C)methyl)acetamide;zinc |
| PubChem CID | 175804648 |
| Molecular Formula | C4H8NOZn- |
| Molecular Weight | 153.49 g/mol |
| Exact Mass | 152.00 |
| IUPAC Name | N,N-di((113C)methyl)acetamide;zinc |
| SMILES | [CH2-]C(=O)N([13CH3])[13CH3].[Zn] |
| InChI | InChI=1S/C4H8NO.Zn/c1-4(6)5(2)3;/h1H2,2-3H3;/q-1;/i2+1,3+1; |
| InChIKey | GVTSSHRLNOXJFG-MEFQWSPQSA-N |
| XLogP | -0.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.49 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-di((113C)methyl)acetamide;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-di((113C)methyl)acetamide;zinc?
The IUPAC name of N,N-di((113C)methyl)acetamide;zinc (CID 175804648) is N,N-di((113C)methyl)acetamide;zinc.
What is the SMILES notation for N,N-di((113C)methyl)acetamide;zinc?
The canonical SMILES for N,N-di((113C)methyl)acetamide;zinc is [CH2-]C(=O)N([13CH3])[13CH3].[Zn].
What is the InChIKey of N,N-di((113C)methyl)acetamide;zinc?
The InChIKey is GVTSSHRLNOXJFG-MEFQWSPQSA-N. The full InChI is InChI=1S/C4H8NO.Zn/c1-4(6)5(2)3;/h1H2,2-3H3;/q-1;/i2+1,3+1;.
What are the key properties of N,N-di((113C)methyl)acetamide;zinc?
N,N-di((113C)methyl)acetamide;zinc has a molecular weight of 153.49 g/mol, XLogP of -0.09, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-di((113C)methyl)acetamide;zinc is sourced from PubChem (CID 175804648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).