C21H22AsClN3O — CID 87816669
CID 87816669 (PubChem CID 87816669) has the molecular formula C21H22AsClN3O and a molecular weight of 442.80 g/mol.
| Compound Name | CID 87816669 |
|---|---|
| PubChem CID | 87816669 |
| Molecular Formula | C21H22AsClN3O |
| Molecular Weight | 442.80 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | — |
| SMILES | Cn1ccc2c([As]c3cccc(Cl)c3)ncc(C(=O)NC3CCCCC3)c21 |
| InChI | InChI=1S/C21H22AsClN3O/c1-26-11-10-17-19(26)18(21(27)25-16-8-3-2-4-9-16)13-24-20(17)22-14-6-5-7-15(23)12-14/h5-7,10-13,16H,2-4,8-9H2,1H3,(H,25,27) |
| InChIKey | DFJNOQJAFZYMJU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.80 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|