C27H45NO3 — CID 87817168
4-[2-[bis(3-hydroxy-3-prop-2-enylhex-5-enyl)amino]ethyl]hepta-1,6-dien-4-ol (PubChem CID 87817168) has the molecular formula C27H45NO3 and a molecular weight of 431.66 g/mol. Its IUPAC name is 4-[2-[bis(3-hydroxy-3-prop-2-enylhex-5-enyl)amino]ethyl]hepta-1,6-dien-4-ol.
| Compound Name | 4-[2-[bis(3-hydroxy-3-prop-2-enylhex-5-enyl)amino]ethyl]hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 87817168 |
| Molecular Formula | C27H45NO3 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | 4-[2-[bis(3-hydroxy-3-prop-2-enylhex-5-enyl)amino]ethyl]hepta-1,6-dien-4-ol |
| SMILES | C=CCC(O)(CC=C)CCN(CCC(O)(CC=C)CC=C)CCC(O)(CC=C)CC=C |
| InChI | InChI=1S/C27H45NO3/c1-7-13-25(29,14-8-2)19-22-28(23-20-26(30,15-9-3)16-10-4)24-21-27(31,17-11-5)18-12-6/h7-12,29-31H,1-6,13-24H2 |
| InChIKey | YGMFWFZDWBUZLN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|