C19H19NO2S2 — CID 87817196
N-[(2,4-dimethoxyphenyl)methyl]-3-methyl-1-benzothiophene-2-carbothioamide (PubChem CID 87817196) has the molecular formula C19H19NO2S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-3-methyl-1-benzothiophene-2-carbothioamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-3-methyl-1-benzothiophene-2-carbothioamide |
|---|---|
| PubChem CID | 87817196 |
| Molecular Formula | C19H19NO2S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-3-methyl-1-benzothiophene-2-carbothioamide |
| SMILES | COc1ccc(CNC(=S)c2sc3ccccc3c2C)c(OC)c1 |
| InChI | InChI=1S/C19H19NO2S2/c1-12-15-6-4-5-7-17(15)24-18(12)19(23)20-11-13-8-9-14(21-2)10-16(13)22-3/h4-10H,11H2,1-3H3,(H,20,23) |
| InChIKey | NOCFTWWSMVJEBK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|