C19H23NO5S — CID 87720762
N-[(2,4-dimethoxyphenyl)methyl]-3,4,5-trimethoxybenzenecarbothioamide (PubChem CID 87720762) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-3,4,5-trimethoxybenzenecarbothioamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-3,4,5-trimethoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 87720762 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-3,4,5-trimethoxybenzenecarbothioamide |
| SMILES | COc1ccc(CNC(=S)c2cc(OC)c(OC)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C19H23NO5S/c1-21-14-7-6-12(15(10-14)22-2)11-20-19(26)13-8-16(23-3)18(25-5)17(9-13)24-4/h6-10H,11H2,1-5H3,(H,20,26) |
| InChIKey | XQUUUMZBOKTRCS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|