C35H50N2 — CID 87819638
[4-butyl-2-(4-butylphenyl)-5-(3-hexylphenyl)-3-pentylpyrrol-1-ium-1-ylidene]azanide (PubChem CID 87819638) has the molecular formula C35H50N2 and a molecular weight of 498.80 g/mol. Its IUPAC name is [4-butyl-2-(4-butylphenyl)-5-(3-hexylphenyl)-3-pentylpyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [4-butyl-2-(4-butylphenyl)-5-(3-hexylphenyl)-3-pentylpyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87819638 |
| Molecular Formula | C35H50N2 |
| Molecular Weight | 498.80 g/mol |
| Exact Mass | 498.40 |
| IUPAC Name | [4-butyl-2-(4-butylphenyl)-5-(3-hexylphenyl)-3-pentylpyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCc1cccc(C2=C(CCCC)C(CCCCC)=C(c3ccc(CCCC)cc3)[N+]2=[N-])c1 |
| InChI | InChI=1S/C35H50N2/c1-5-9-13-15-18-29-19-16-20-31(27-29)35-32(21-12-8-4)33(22-14-10-6-2)34(37(35)36)30-25-23-28(24-26-30)17-11-7-3/h16,19-20,23-27H,5-15,17-18,21-22H2,1-4H3 |
| InChIKey | KSMLRZWBQNZAMU-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.80 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|