C36H52N2 — CID 87817989
[3,4-dibutyl-2-(3-butylphenyl)-5-(3-octylphenyl)pyrrol-1-ium-1-ylidene]azanide (PubChem CID 87817989) has the molecular formula C36H52N2 and a molecular weight of 512.83 g/mol. Its IUPAC name is [3,4-dibutyl-2-(3-butylphenyl)-5-(3-octylphenyl)pyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [3,4-dibutyl-2-(3-butylphenyl)-5-(3-octylphenyl)pyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87817989 |
| Molecular Formula | C36H52N2 |
| Molecular Weight | 512.83 g/mol |
| Exact Mass | 512.41 |
| IUPAC Name | [3,4-dibutyl-2-(3-butylphenyl)-5-(3-octylphenyl)pyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCCCc1cccc(C2=C(CCCC)C(CCCC)=C(c3cccc(CCCC)c3)[N+]2=[N-])c1 |
| InChI | InChI=1S/C36H52N2/c1-5-9-13-14-15-16-20-30-22-18-24-32(28-30)36-34(26-12-8-4)33(25-11-7-3)35(38(36)37)31-23-17-21-29(27-31)19-10-6-2/h17-18,21-24,27-28H,5-16,19-20,25-26H2,1-4H3 |
| InChIKey | GTKFRUXKQKUEHI-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.83 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|