C37H54N2 — CID 87819258
[2-(3-hexylphenyl)-3,4-dipentyl-5-(3-pentylphenyl)pyrrol-1-ium-1-ylidene]azanide (PubChem CID 87819258) has the molecular formula C37H54N2 and a molecular weight of 526.85 g/mol. Its IUPAC name is [2-(3-hexylphenyl)-3,4-dipentyl-5-(3-pentylphenyl)pyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [2-(3-hexylphenyl)-3,4-dipentyl-5-(3-pentylphenyl)pyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87819258 |
| Molecular Formula | C37H54N2 |
| Molecular Weight | 526.85 g/mol |
| Exact Mass | 526.43 |
| IUPAC Name | [2-(3-hexylphenyl)-3,4-dipentyl-5-(3-pentylphenyl)pyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCc1cccc(C2=C(CCCCC)C(CCCCC)=C(c3cccc(CCCCC)c3)[N+]2=[N-])c1 |
| InChI | InChI=1S/C37H54N2/c1-5-9-13-17-21-31-23-19-25-33(29-31)37-35(27-16-12-8-4)34(26-15-11-7-3)36(39(37)38)32-24-18-22-30(28-32)20-14-10-6-2/h18-19,22-25,28-29H,5-17,20-21,26-27H2,1-4H3 |
| InChIKey | BHSJUGBMNCKXFJ-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.85 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|