C42H64N2 — CID 87820438
[3-butyl-4-hexyl-2,5-bis(3-octylphenyl)pyrrol-1-ium-1-ylidene]azanide (PubChem CID 87820438) has the molecular formula C42H64N2 and a molecular weight of 596.99 g/mol. Its IUPAC name is [3-butyl-4-hexyl-2,5-bis(3-octylphenyl)pyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [3-butyl-4-hexyl-2,5-bis(3-octylphenyl)pyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87820438 |
| Molecular Formula | C42H64N2 |
| Molecular Weight | 596.99 g/mol |
| Exact Mass | 596.51 |
| IUPAC Name | [3-butyl-4-hexyl-2,5-bis(3-octylphenyl)pyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCCCc1cccc(C2=C(CCCC)C(CCCCCC)=C(c3cccc(CCCCCCCC)c3)[N+]2=[N-])c1 |
| InChI | InChI=1S/C42H64N2/c1-5-9-13-16-18-20-25-35-27-23-29-37(33-35)41-39(31-12-8-4)40(32-22-15-11-7-3)42(44(41)43)38-30-24-28-36(34-38)26-21-19-17-14-10-6-2/h23-24,27-30,33-34H,5-22,25-26,31-32H2,1-4H3 |
| InChIKey | QLQUDBGROVFDHA-UHFFFAOYSA-N |
| XLogP | 13.82 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.99 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|