C16H19FN4O3S — CID 87824623
2-[[(5S)-3-[3-fluoro-4-(3-methyl-2-oxoimidazolidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylamino]ethanethial (PubChem CID 87824623) has the molecular formula C16H19FN4O3S and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-[[(5S)-3-[3-fluoro-4-(3-methyl-2-oxoimidazolidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylamino]ethanethial.
| Compound Name | 2-[[(5S)-3-[3-fluoro-4-(3-methyl-2-oxoimidazolidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylamino]ethanethial |
|---|---|
| PubChem CID | 87824623 |
| Molecular Formula | C16H19FN4O3S |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[[(5S)-3-[3-fluoro-4-(3-methyl-2-oxoimidazolidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylamino]ethanethial |
| SMILES | CN1CCN(c2ccc(N3C[C@H](CNCC=S)OC3=O)cc2F)C1=O |
| InChI | InChI=1S/C16H19FN4O3S/c1-19-5-6-20(15(19)22)14-3-2-11(8-13(14)17)21-10-12(24-16(21)23)9-18-4-7-25/h2-3,7-8,12,18H,4-6,9-10H2,1H3/t12-/m0/s1 |
| InChIKey | SYONFGZTXONWBV-LBPRGKRZSA-N |
| XLogP | 1.61 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|