C21H36O5 — CID 87824901
2,3-dihydroxypropyl (9Z,12Z,15Z)-octadeca-9,12,15-trieneperoxoate (PubChem CID 87824901) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (9Z,12Z,15Z)-octadeca-9,12,15-trieneperoxoate.
| Compound Name | 2,3-dihydroxypropyl (9Z,12Z,15Z)-octadeca-9,12,15-trieneperoxoate |
|---|---|
| PubChem CID | 87824901 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 2,3-dihydroxypropyl (9Z,12Z,15Z)-octadeca-9,12,15-trieneperoxoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OOCC(O)CO |
| InChI | InChI=1S/C21H36O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)26-25-19-20(23)18-22/h3-4,6-7,9-10,20,22-23H,2,5,8,11-19H2,1H3/b4-3-,7-6-,10-9- |
| InChIKey | FUWLMYGSYJMVNS-PDBXOOCHSA-N |
| XLogP | 4.40 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|