C21H15N3O6 — CID 8782564
[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate (PubChem CID 8782564) has the molecular formula C21H15N3O6 and a molecular weight of 405.37 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate.
| Compound Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8782564 |
| Molecular Formula | C21H15N3O6 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)OCC(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C21H15N3O6/c1-12-19(14(9-22)20(30-12)24-6-2-3-7-24)21(27)29-10-16(25)13-4-5-17-15(8-13)23-18(26)11-28-17/h2-8H,10-11H2,1H3,(H,23,26) |
| InChIKey | SWBVQILPTQUVFA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|