C35H38F2N3O3+ — CID 87827295
(3-carbamoyl-5-ethynylbenzoyl)-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethynylphenyl)methylamino]-3-hydroxybutan-2-yl]-dipropylazanium (PubChem CID 87827295) has the molecular formula C35H38F2N3O3+ and a molecular weight of 586.70 g/mol. Its IUPAC name is (3-carbamoyl-5-ethynylbenzoyl)-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethynylphenyl)methylamino]-3-hydroxybutan-2-yl]-dipropylazanium.
| Compound Name | (3-carbamoyl-5-ethynylbenzoyl)-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethynylphenyl)methylamino]-3-hydroxybutan-2-yl]-dipropylazanium |
|---|---|
| PubChem CID | 87827295 |
| Molecular Formula | C35H38F2N3O3+ |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | (3-carbamoyl-5-ethynylbenzoyl)-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethynylphenyl)methylamino]-3-hydroxybutan-2-yl]-dipropylazanium |
| SMILES | C#Cc1cccc(CNC[C@@H](O)[C@H](Cc2cc(F)cc(F)c2)[N+](CCC)(CCC)C(=O)c2cc(C#C)cc(C(N)=O)c2)c1 |
| InChI | InChI=1S/C35H37F2N3O3/c1-5-12-40(13-6-2,35(43)29-16-25(8-4)15-28(20-29)34(38)42)32(19-27-17-30(36)21-31(37)18-27)33(41)23-39-22-26-11-9-10-24(7-3)14-26/h3-4,9-11,14-18,20-21,32-33,39,41H,5-6,12-13,19,22-23H2,1-2H3,(H-,38,42)/p+1/t32-,33+/m0/s1 |
| InChIKey | WLAAFGORSWHWCP-JHOUSYSJSA-O |
| XLogP | 4.57 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|