C35H42F2N4O6S — CID 87828574
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethynylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-(2-hydroxyethylsulfamoyl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 87828574) has the molecular formula C35H42F2N4O6S and a molecular weight of 684.81 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethynylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-(2-hydroxyethylsulfamoyl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethynylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-(2-hydroxyethylsulfamoyl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 87828574 |
| Molecular Formula | C35H42F2N4O6S |
| Molecular Weight | 684.81 g/mol |
| Exact Mass | 684.28 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethynylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-(2-hydroxyethylsulfamoyl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | C#Cc1cccc(CNC[C@@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)c2cc(C(=O)N(CCC)CCC)cc(S(=O)(=O)NCCO)c2)c1 |
| InChI | InChI=1S/C35H42F2N4O6S/c1-4-11-41(12-5-2)35(45)28-18-27(19-31(20-28)48(46,47)39-10-13-42)34(44)40-32(17-26-15-29(36)21-30(37)16-26)33(43)23-38-22-25-9-7-8-24(6-3)14-25/h3,7-9,14-16,18-21,32-33,38-39,42-43H,4-5,10-13,17,22-23H2,1-2H3,(H,40,44)/t32-,33+/m0/s1 |
| InChIKey | PLOZVBREVZCBJH-JHOUSYSJSA-N |
| XLogP | 2.97 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.81 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|