C15H19AsN4O3S — CID 87827558
CID 87827558 (PubChem CID 87827558) has the molecular formula C15H19AsN4O3S and a molecular weight of 410.33 g/mol.
| Compound Name | CID 87827558 |
|---|---|
| PubChem CID | 87827558 |
| Molecular Formula | C15H19AsN4O3S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | — |
| SMILES | CC(C)Cn1cnc2c([As])nc3cccnc3c21.CCS(=O)(=O)O |
| InChI | InChI=1S/C13H13AsN4.C2H6O3S/c1-8(2)6-18-7-16-11-12(18)10-9(17-13(11)14)4-3-5-15-10;1-2-6(3,4)5/h3-5,7-8H,6H2,1-2H3;2H2,1H3,(H,3,4,5) |
| InChIKey | HJDUOWHYEIHUOY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|