C19H24N4O2 — CID 91299827
ethyl 4-(4-butan-2-ylimidazo[4,5-c][1,5]naphthyridin-1-yl)butanoate (PubChem CID 91299827) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is ethyl 4-(4-butan-2-ylimidazo[4,5-c][1,5]naphthyridin-1-yl)butanoate.
| Compound Name | ethyl 4-(4-butan-2-ylimidazo[4,5-c][1,5]naphthyridin-1-yl)butanoate |
|---|---|
| PubChem CID | 91299827 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | ethyl 4-(4-butan-2-ylimidazo[4,5-c][1,5]naphthyridin-1-yl)butanoate |
| SMILES | CCOC(=O)CCCn1cnc2c(C(C)CC)nc3cccnc3c21 |
| InChI | InChI=1S/C19H24N4O2/c1-4-13(3)16-18-19(17-14(22-16)8-6-10-20-17)23(12-21-18)11-7-9-15(24)25-5-2/h6,8,10,12-13H,4-5,7,9,11H2,1-3H3 |
| InChIKey | HXFNKKOTUXNIAP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |