C23H31F3N2O6S — CID 87831399
tert-butyl (2S)-2-[2-oxo-2-[[6-(trifluoromethylsulfonyloxy)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]piperidine-1-carboxylate (PubChem CID 87831399) has the molecular formula C23H31F3N2O6S and a molecular weight of 520.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-[2-oxo-2-[[6-(trifluoromethylsulfonyloxy)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[2-oxo-2-[[6-(trifluoromethylsulfonyloxy)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87831399 |
| Molecular Formula | C23H31F3N2O6S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | tert-butyl (2S)-2-[2-oxo-2-[[6-(trifluoromethylsulfonyloxy)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1CC(=O)NC1CCCc2cc(OS(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C23H31F3N2O6S/c1-22(2,3)33-21(30)28-12-5-4-8-16(28)14-20(29)27-19-9-6-7-15-13-17(10-11-18(15)19)34-35(31,32)23(24,25)26/h10-11,13,16,19H,4-9,12,14H2,1-3H3,(H,27,29)/t16-,19?/m0/s1 |
| InChIKey | DDFYPDPJIQECPN-UCFFOFKASA-N |
| XLogP | 4.59 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|