C15H23NO6S3 — CID 87831882
[(2S,4R)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylsulfonylpyrrolidin-2-yl]methyl methanesulfonate (PubChem CID 87831882) has the molecular formula C15H23NO6S3 and a molecular weight of 409.55 g/mol. Its IUPAC name is [(2S,4R)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylsulfonylpyrrolidin-2-yl]methyl methanesulfonate.
| Compound Name | [(2S,4R)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylsulfonylpyrrolidin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 87831882 |
| Molecular Formula | C15H23NO6S3 |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | [(2S,4R)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylsulfonylpyrrolidin-2-yl]methyl methanesulfonate |
| SMILES | COc1ccc(CS[C@@H]2C[C@@H](COS(C)(=O)=O)N(S(C)(=O)=O)C2)cc1 |
| InChI | InChI=1S/C15H23NO6S3/c1-21-14-6-4-12(5-7-14)11-23-15-8-13(10-22-25(3,19)20)16(9-15)24(2,17)18/h4-7,13,15H,8-11H2,1-3H3/t13-,15+/m0/s1 |
| InChIKey | NDRCBHVDGKUZCT-DZGCQCFKSA-N |
| XLogP | 1.31 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|