C23H27Cl2N3O4S — CID 87832846
[cyclohexyl-[2-[(2,6-dichlorophenyl)carbamoylamino]-5-propan-2-ylthiophene-3-carbonyl]amino] acetate (PubChem CID 87832846) has the molecular formula C23H27Cl2N3O4S and a molecular weight of 512.46 g/mol. Its IUPAC name is [cyclohexyl-[2-[(2,6-dichlorophenyl)carbamoylamino]-5-propan-2-ylthiophene-3-carbonyl]amino] acetate.
| Compound Name | [cyclohexyl-[2-[(2,6-dichlorophenyl)carbamoylamino]-5-propan-2-ylthiophene-3-carbonyl]amino] acetate |
|---|---|
| PubChem CID | 87832846 |
| Molecular Formula | C23H27Cl2N3O4S |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | [cyclohexyl-[2-[(2,6-dichlorophenyl)carbamoylamino]-5-propan-2-ylthiophene-3-carbonyl]amino] acetate |
| SMILES | CC(=O)ON(C(=O)c1cc(C(C)C)sc1NC(=O)Nc1c(Cl)cccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C23H27Cl2N3O4S/c1-13(2)19-12-16(22(30)28(32-14(3)29)15-8-5-4-6-9-15)21(33-19)27-23(31)26-20-17(24)10-7-11-18(20)25/h7,10-13,15H,4-6,8-9H2,1-3H3,(H2,26,27,31) |
| InChIKey | MOFKGLZISOKIDR-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|