About 2,4-dioxopentanoic acid;rhodium
2,4-dioxopentanoic acid;rhodium (PubChem CID 87833287) has the molecular formula C5H6O4Rh
and a molecular weight of 233.00 g/mol. Its IUPAC name is 2,4-dioxopentanoic acid;rhodium.
Molecular Properties
| Compound Name | 2,4-dioxopentanoic acid;rhodium |
| PubChem CID | 87833287 |
| Molecular Formula | C5H6O4Rh |
| Molecular Weight | 233.00 g/mol |
| Exact Mass | 232.93 |
| IUPAC Name | 2,4-dioxopentanoic acid;rhodium |
| SMILES | CC(=O)CC(=O)C(=O)O.[Rh] |
| InChI | InChI=1S/C5H6O4.Rh/c1-3(6)2-4(7)5(8)9;/h2H2,1H3,(H,8,9); |
| InChIKey | NZGOXIFJNVNROH-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.00 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dioxopentanoic acid;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dioxopentanoic acid;rhodium?
The IUPAC name of 2,4-dioxopentanoic acid;rhodium (CID 87833287) is 2,4-dioxopentanoic acid;rhodium.
What is the SMILES notation for 2,4-dioxopentanoic acid;rhodium?
The canonical SMILES for 2,4-dioxopentanoic acid;rhodium is CC(=O)CC(=O)C(=O)O.[Rh].
What is the InChIKey of 2,4-dioxopentanoic acid;rhodium?
The InChIKey is NZGOXIFJNVNROH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4.Rh/c1-3(6)2-4(7)5(8)9;/h2H2,1H3,(H,8,9);.
What are the key properties of 2,4-dioxopentanoic acid;rhodium?
2,4-dioxopentanoic acid;rhodium has a molecular weight of 233.00 g/mol, XLogP of -0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxopentanoic acid;rhodium is sourced from PubChem (CID 87833287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).