C18H23N3O5S — CID 87835483
tert-butyl N-[[2-(5-methoxy-1H-indol-3-yl)acetyl]carbamoyl]-N-methylsulfanylcarbamate (PubChem CID 87835483) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is tert-butyl N-[[2-(5-methoxy-1H-indol-3-yl)acetyl]carbamoyl]-N-methylsulfanylcarbamate.
| Compound Name | tert-butyl N-[[2-(5-methoxy-1H-indol-3-yl)acetyl]carbamoyl]-N-methylsulfanylcarbamate |
|---|---|
| PubChem CID | 87835483 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | tert-butyl N-[[2-(5-methoxy-1H-indol-3-yl)acetyl]carbamoyl]-N-methylsulfanylcarbamate |
| SMILES | COc1ccc2[nH]cc(CC(=O)NC(=O)N(SC)C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C18H23N3O5S/c1-18(2,3)26-17(24)21(27-5)16(23)20-15(22)8-11-10-19-14-7-6-12(25-4)9-13(11)14/h6-7,9-10,19H,8H2,1-5H3,(H,20,22,23) |
| InChIKey | LGWIKDYJLYBBIR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|