C21H22F3N4O2+ — CID 87837424
(2S)-3-(2-aminobenzimidazol-1-yl)-1-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-ium-2-carboxylic acid (PubChem CID 87837424) has the molecular formula C21H22F3N4O2+ and a molecular weight of 419.43 g/mol. Its IUPAC name is (2S)-3-(2-aminobenzimidazol-1-yl)-1-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-ium-2-carboxylic acid.
| Compound Name | (2S)-3-(2-aminobenzimidazol-1-yl)-1-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 87837424 |
| Molecular Formula | C21H22F3N4O2+ |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (2S)-3-(2-aminobenzimidazol-1-yl)-1-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-ium-2-carboxylic acid |
| SMILES | C[N+]1(Cc2cccc(C(F)(F)F)c2)CCC(n2c(N)nc3ccccc32)[C@H]1C(=O)O |
| InChI | InChI=1S/C21H21F3N4O2/c1-28(12-13-5-4-6-14(11-13)21(22,23)24)10-9-17(18(28)19(29)30)27-16-8-3-2-7-15(16)26-20(27)25/h2-8,11,17-18H,9-10,12H2,1H3,(H2-,25,26,29,30)/p+1/t17?,18-,28?/m0/s1 |
| InChIKey | NFIKPLZTADNVSL-PBRZOGGKSA-O |
| XLogP | 3.68 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|