C28H50O5 — CID 87839945
5a,9a-bis(8-methylnonyl)-6,7,8,9-tetrahydrobenzo[e]trioxepine-1,5-dione (PubChem CID 87839945) has the molecular formula C28H50O5 and a molecular weight of 466.70 g/mol. Its IUPAC name is 5a,9a-bis(8-methylnonyl)-6,7,8,9-tetrahydrobenzo[e]trioxepine-1,5-dione.
| Compound Name | 5a,9a-bis(8-methylnonyl)-6,7,8,9-tetrahydrobenzo[e]trioxepine-1,5-dione |
|---|---|
| PubChem CID | 87839945 |
| Molecular Formula | C28H50O5 |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 466.37 |
| IUPAC Name | 5a,9a-bis(8-methylnonyl)-6,7,8,9-tetrahydrobenzo[e]trioxepine-1,5-dione |
| SMILES | CC(C)CCCCCCCC12CCCCC1(CCCCCCCC(C)C)C(=O)OOOC2=O |
| InChI | InChI=1S/C28H50O5/c1-23(2)17-11-7-5-9-13-19-27-21-15-16-22-28(27,26(30)32-33-31-25(27)29)20-14-10-6-8-12-18-24(3)4/h23-24H,5-22H2,1-4H3 |
| InChIKey | OKLRFJWGICPADM-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|