C28H52O4 — CID 151307557
1-(6-methylheptyl)-2-(10-methylundecyl)cyclohexane-1,2-dicarboxylic acid (PubChem CID 151307557) has the molecular formula C28H52O4 and a molecular weight of 452.72 g/mol. Its IUPAC name is 1-(6-methylheptyl)-2-(10-methylundecyl)cyclohexane-1,2-dicarboxylic acid.
| Compound Name | 1-(6-methylheptyl)-2-(10-methylundecyl)cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 151307557 |
| Molecular Formula | C28H52O4 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.39 |
| IUPAC Name | 1-(6-methylheptyl)-2-(10-methylundecyl)cyclohexane-1,2-dicarboxylic acid |
| SMILES | CC(C)CCCCCCCCCC1(C(=O)O)CCCCC1(CCCCCC(C)C)C(=O)O |
| InChI | InChI=1S/C28H52O4/c1-23(2)17-11-8-6-5-7-9-13-19-27(25(29)30)21-15-16-22-28(27,26(31)32)20-14-10-12-18-24(3)4/h23-24H,5-22H2,1-4H3,(H,29,30)(H,31,32) |
| InChIKey | ODSQDIPROUWNLM-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|