C28H52O4 — CID 151776571
1-(6-methylheptyl)-2-(10-methylundecyl)cyclohexane-1,3-dicarboxylic acid (PubChem CID 151776571) has the molecular formula C28H52O4 and a molecular weight of 452.72 g/mol. Its IUPAC name is 1-(6-methylheptyl)-2-(10-methylundecyl)cyclohexane-1,3-dicarboxylic acid.
| Compound Name | 1-(6-methylheptyl)-2-(10-methylundecyl)cyclohexane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 151776571 |
| Molecular Formula | C28H52O4 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.39 |
| IUPAC Name | 1-(6-methylheptyl)-2-(10-methylundecyl)cyclohexane-1,3-dicarboxylic acid |
| SMILES | CC(C)CCCCCCCCCC1C(C(=O)O)CCCC1(CCCCCC(C)C)C(=O)O |
| InChI | InChI=1S/C28H52O4/c1-22(2)16-11-8-6-5-7-9-13-19-25-24(26(29)30)18-15-21-28(25,27(31)32)20-14-10-12-17-23(3)4/h22-25H,5-21H2,1-4H3,(H,29,30)(H,31,32) |
| InChIKey | RTRXGYOCMZVHGU-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|