C27H50O4 — CID 151329555
2-(8-methylnonyl)-1-(7-methyloctyl)cyclohexane-1,4-dicarboxylic acid (PubChem CID 151329555) has the molecular formula C27H50O4 and a molecular weight of 438.69 g/mol. Its IUPAC name is 2-(8-methylnonyl)-1-(7-methyloctyl)cyclohexane-1,4-dicarboxylic acid.
| Compound Name | 2-(8-methylnonyl)-1-(7-methyloctyl)cyclohexane-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 151329555 |
| Molecular Formula | C27H50O4 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | 2-(8-methylnonyl)-1-(7-methyloctyl)cyclohexane-1,4-dicarboxylic acid |
| SMILES | CC(C)CCCCCCCC1CC(C(=O)O)CCC1(CCCCCCC(C)C)C(=O)O |
| InChI | InChI=1S/C27H50O4/c1-21(2)14-10-6-5-7-12-16-24-20-23(25(28)29)17-19-27(24,26(30)31)18-13-9-8-11-15-22(3)4/h21-24H,5-20H2,1-4H3,(H,28,29)(H,30,31) |
| InChIKey | OIDZIIIBFGRONG-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|