C45H84O6 — CID 156761699
3-[3,4-bis(2-carboxyethyl)-2,3,4-tris(8-methylnonyl)cyclohexyl]propanoic acid (PubChem CID 156761699) has the molecular formula C45H84O6 and a molecular weight of 721.16 g/mol. Its IUPAC name is 3-[3,4-bis(2-carboxyethyl)-2,3,4-tris(8-methylnonyl)cyclohexyl]propanoic acid.
| Compound Name | 3-[3,4-bis(2-carboxyethyl)-2,3,4-tris(8-methylnonyl)cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 156761699 |
| Molecular Formula | C45H84O6 |
| Molecular Weight | 721.16 g/mol |
| Exact Mass | 720.63 |
| IUPAC Name | 3-[3,4-bis(2-carboxyethyl)-2,3,4-tris(8-methylnonyl)cyclohexyl]propanoic acid |
| SMILES | CC(C)CCCCCCCC1C(CCC(=O)O)CCC(CCCCCCCC(C)C)(CCC(=O)O)C1(CCCCCCCC(C)C)CCC(=O)O |
| InChI | InChI=1S/C45H84O6/c1-36(2)22-16-10-7-13-19-25-40-39(26-27-41(46)47)28-33-44(34-29-42(48)49,31-20-14-8-11-17-23-37(3)4)45(40,35-30-43(50)51)32-21-15-9-12-18-24-38(5)6/h36-40H,7-35H2,1-6H3,(H,46,47)(H,48,49)(H,50,51) |
| InChIKey | JIRVLYSKQVPWGD-UHFFFAOYSA-N |
| XLogP | 13.74 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.16 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|