C22H40O4 — CID 154014185
2-(8-methylnonyl)-1-(2-methylpropyl)cyclohexane-1,3-dicarboxylic acid (PubChem CID 154014185) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is 2-(8-methylnonyl)-1-(2-methylpropyl)cyclohexane-1,3-dicarboxylic acid.
| Compound Name | 2-(8-methylnonyl)-1-(2-methylpropyl)cyclohexane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 154014185 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 2-(8-methylnonyl)-1-(2-methylpropyl)cyclohexane-1,3-dicarboxylic acid |
| SMILES | CC(C)CCCCCCCC1C(C(=O)O)CCCC1(CC(C)C)C(=O)O |
| InChI | InChI=1S/C22H40O4/c1-16(2)11-8-6-5-7-9-13-19-18(20(23)24)12-10-14-22(19,21(25)26)15-17(3)4/h16-19H,5-15H2,1-4H3,(H,23,24)(H,25,26) |
| InChIKey | WVZXFIQYLSHWCR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|