C21H38O4 — CID 150703705
2-(7-methyloctyl)-1-(2-methylpropyl)cyclohexane-1,3-dicarboxylic acid (PubChem CID 150703705) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is 2-(7-methyloctyl)-1-(2-methylpropyl)cyclohexane-1,3-dicarboxylic acid.
| Compound Name | 2-(7-methyloctyl)-1-(2-methylpropyl)cyclohexane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150703705 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | 2-(7-methyloctyl)-1-(2-methylpropyl)cyclohexane-1,3-dicarboxylic acid |
| SMILES | CC(C)CCCCCCC1C(C(=O)O)CCCC1(CC(C)C)C(=O)O |
| InChI | InChI=1S/C21H38O4/c1-15(2)10-7-5-6-8-12-18-17(19(22)23)11-9-13-21(18,20(24)25)14-16(3)4/h15-18H,5-14H2,1-4H3,(H,22,23)(H,24,25) |
| InChIKey | JMKLYWZFJARUPN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|