C28H48O5 — CID 19607445
3,4-bis(8-methylnonyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid (PubChem CID 19607445) has the molecular formula C28H48O5 and a molecular weight of 464.69 g/mol. Its IUPAC name is 3,4-bis(8-methylnonyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid.
| Compound Name | 3,4-bis(8-methylnonyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 19607445 |
| Molecular Formula | C28H48O5 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | 3,4-bis(8-methylnonyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid |
| SMILES | CC(C)CCCCCCCC1(C(=O)O)C=C2OC2CC1(CCCCCCCC(C)C)C(=O)O |
| InChI | InChI=1S/C28H48O5/c1-21(2)15-11-7-5-9-13-17-27(25(29)30)19-23-24(33-23)20-28(27,26(31)32)18-14-10-6-8-12-16-22(3)4/h19,21-22,24H,5-18,20H2,1-4H3,(H,29,30)(H,31,32) |
| InChIKey | WCBUAKWOTOSZLV-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|