About (4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid
(4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid (PubChem CID 87843365) has the molecular formula C8H15F2O3P
and a molecular weight of 228.17 g/mol. Its IUPAC name is (4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid.
Molecular Properties
| Compound Name | (4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid |
| PubChem CID | 87843365 |
| Molecular Formula | C8H15F2O3P |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid |
| SMILES | CCC(=CCC(F)(F)P(=O)(O)O)CC |
| InChI | InChI=1S/C8H15F2O3P/c1-3-7(4-2)5-6-8(9,10)14(11,12)13/h5H,3-4,6H2,1-2H3,(H2,11,12,13) |
| InChIKey | LSLLKPHCZRKDSQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid?
The IUPAC name of (4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid (CID 87843365) is (4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid.
What is the SMILES notation for (4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid?
The canonical SMILES for (4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid is CCC(=CCC(F)(F)P(=O)(O)O)CC.
What is the InChIKey of (4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid?
The InChIKey is LSLLKPHCZRKDSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2O3P/c1-3-7(4-2)5-6-8(9,10)14(11,12)13/h5H,3-4,6H2,1-2H3,(H2,11,12,13).
What are the key properties of (4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid?
(4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid has a molecular weight of 228.17 g/mol, XLogP of 2.89, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-1,1-difluorohex-3-enyl)phosphonic acid is sourced from PubChem (CID 87843365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).