C14H6F6 — CID 87845113
1,1,2,2,3,4-hexafluoroanthracene (PubChem CID 87845113) has the molecular formula C14H6F6 and a molecular weight of 288.19 g/mol. Its IUPAC name is 1,1,2,2,3,4-hexafluoroanthracene.
| Compound Name | 1,1,2,2,3,4-hexafluoroanthracene |
|---|---|
| PubChem CID | 87845113 |
| Molecular Formula | C14H6F6 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1,1,2,2,3,4-hexafluoroanthracene |
| SMILES | FC1=C(F)C(F)(F)C(F)(F)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C14H6F6/c15-11-9-5-7-3-1-2-4-8(7)6-10(9)13(17,18)14(19,20)12(11)16/h1-6H |
| InChIKey | XFFPNHJQRAFORX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|