C18H19Cl2N5O4S — CID 87846665
2-[4-[2-[(3S)-4-(2,3-dichlorophenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetyl]piperazin-1-yl]acetonitrile (PubChem CID 87846665) has the molecular formula C18H19Cl2N5O4S and a molecular weight of 472.35 g/mol. Its IUPAC name is 2-[4-[2-[(3S)-4-(2,3-dichlorophenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetyl]piperazin-1-yl]acetonitrile.
| Compound Name | 2-[4-[2-[(3S)-4-(2,3-dichlorophenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetyl]piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 87846665 |
| Molecular Formula | C18H19Cl2N5O4S |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 2-[4-[2-[(3S)-4-(2,3-dichlorophenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetyl]piperazin-1-yl]acetonitrile |
| SMILES | N#CCN1CCN(C(=O)C[C@H]2C(=O)NC=CN2S(=O)(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C18H19Cl2N5O4S/c19-13-2-1-3-15(17(13)20)30(28,29)25-7-5-22-18(27)14(25)12-16(26)24-10-8-23(6-4-21)9-11-24/h1-3,5,7,14H,6,8-12H2,(H,22,27)/t14-/m0/s1 |
| InChIKey | ZPAMXYZTTHTLKV-AWEZNQCLSA-N |
| XLogP | 1.01 |
| TPSA | 113.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|