C20H20N4O2S — CID 87849916
(2R)-3-benzylsulfanyl-N-(cyanomethyl)-2-(3-pyridin-3-ylprop-2-enoylamino)propanamide (PubChem CID 87849916) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is (2R)-3-benzylsulfanyl-N-(cyanomethyl)-2-(3-pyridin-3-ylprop-2-enoylamino)propanamide.
| Compound Name | (2R)-3-benzylsulfanyl-N-(cyanomethyl)-2-(3-pyridin-3-ylprop-2-enoylamino)propanamide |
|---|---|
| PubChem CID | 87849916 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (2R)-3-benzylsulfanyl-N-(cyanomethyl)-2-(3-pyridin-3-ylprop-2-enoylamino)propanamide |
| SMILES | N#CCNC(=O)[C@H](CSCc1ccccc1)NC(=O)C=Cc1cccnc1 |
| InChI | InChI=1S/C20H20N4O2S/c21-10-12-23-20(26)18(15-27-14-17-5-2-1-3-6-17)24-19(25)9-8-16-7-4-11-22-13-16/h1-9,11,13,18H,12,14-15H2,(H,23,26)(H,24,25)/t18-/m0/s1 |
| InChIKey | ITTXRPJRTFMHBT-SFHVURJKSA-N |
| XLogP | 2.15 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|