C20H28N4O4 — CID 87850229
tert-butyl N-[3-[cyanomethylcarbamoyl(pentyl)carbamoyl]phenyl]carbamate (PubChem CID 87850229) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is tert-butyl N-[3-[cyanomethylcarbamoyl(pentyl)carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[cyanomethylcarbamoyl(pentyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 87850229 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | tert-butyl N-[3-[cyanomethylcarbamoyl(pentyl)carbamoyl]phenyl]carbamate |
| SMILES | CCCCCN(C(=O)NCC#N)C(=O)c1cccc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C20H28N4O4/c1-5-6-7-13-24(18(26)22-12-11-21)17(25)15-9-8-10-16(14-15)23-19(27)28-20(2,3)4/h8-10,14H,5-7,12-13H2,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | VOBIHMMJYGTPSE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|