C19H19F5N2O — CID 87852247
4-[4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazin-1-yl]phenol (PubChem CID 87852247) has the molecular formula C19H19F5N2O and a molecular weight of 386.36 g/mol. Its IUPAC name is 4-[4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 87852247 |
| Molecular Formula | C19H19F5N2O |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 4-[4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazin-1-yl]phenol |
| SMILES | Oc1ccc(N2CCN(Cc3ccc(C(F)(F)C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H19F5N2O/c20-18(21,19(22,23)24)15-3-1-14(2-4-15)13-25-9-11-26(12-10-25)16-5-7-17(27)8-6-16/h1-8,27H,9-13H2 |
| InChIKey | QRUFFRPUVXHMRB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|