About (2-aminoethylamino) 2-ethylhexanoate
(2-aminoethylamino) 2-ethylhexanoate (PubChem CID 87853301) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is (2-aminoethylamino) 2-ethylhexanoate.
Molecular Properties
| Compound Name | (2-aminoethylamino) 2-ethylhexanoate |
| PubChem CID | 87853301 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (2-aminoethylamino) 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)ONCCN |
| InChI | InChI=1S/C10H22N2O2/c1-3-5-6-9(4-2)10(13)14-12-8-7-11/h9,12H,3-8,11H2,1-2H3 |
| InChIKey | OBYLWBKVQSKPLF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-aminoethylamino) 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminoethylamino) 2-ethylhexanoate?
The IUPAC name of (2-aminoethylamino) 2-ethylhexanoate (CID 87853301) is (2-aminoethylamino) 2-ethylhexanoate.
What is the SMILES notation for (2-aminoethylamino) 2-ethylhexanoate?
The canonical SMILES for (2-aminoethylamino) 2-ethylhexanoate is CCCCC(CC)C(=O)ONCCN.
What is the InChIKey of (2-aminoethylamino) 2-ethylhexanoate?
The InChIKey is OBYLWBKVQSKPLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O2/c1-3-5-6-9(4-2)10(13)14-12-8-7-11/h9,12H,3-8,11H2,1-2H3.
What are the key properties of (2-aminoethylamino) 2-ethylhexanoate?
(2-aminoethylamino) 2-ethylhexanoate has a molecular weight of 202.30 g/mol, XLogP of 1.21, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminoethylamino) 2-ethylhexanoate is sourced from PubChem (CID 87853301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).